C18H17N5 — CID 133344856
3-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]propanenitrile (PubChem CID 133344856) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]propanenitrile.
| Compound Name | 3-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 133344856 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]propanenitrile |
| SMILES | CCN(CCC#N)c1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C18H17N5/c1-2-23(12-6-10-19)18-15-8-3-4-9-16(15)21-17(22-18)14-7-5-11-20-13-14/h3-5,7-9,11,13H,2,6,12H2,1H3 |
| InChIKey | WOBIRBKLIORCDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |