C23H31NO — CID 91134659
2-ethyl-2,6-dimethyl-N,4-diphenylheptanamide (PubChem CID 91134659) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethyl-N,4-diphenylheptanamide.
| Compound Name | 2-ethyl-2,6-dimethyl-N,4-diphenylheptanamide |
|---|---|
| PubChem CID | 91134659 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 2-ethyl-2,6-dimethyl-N,4-diphenylheptanamide |
| SMILES | CCC(C)(CC(CC(C)C)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H31NO/c1-5-23(4,22(25)24-21-14-10-7-11-15-21)17-20(16-18(2)3)19-12-8-6-9-13-19/h6-15,18,20H,5,16-17H2,1-4H3,(H,24,25) |
| InChIKey | BWBANPDSSKKDAH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |