C28H33N3O2 — CID 91134877
tert-butyl (2R)-4-benzyl-2-[(2-pyridin-2-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 91134877) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl (2R)-4-benzyl-2-[(2-pyridin-2-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-benzyl-2-[(2-pyridin-2-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91134877 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | tert-butyl (2R)-4-benzyl-2-[(2-pyridin-2-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C[C@H]1Cc1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C28H33N3O2/c1-28(2,3)33-27(32)31-18-17-30(20-22-11-5-4-6-12-22)21-24(31)19-23-13-7-8-14-25(23)26-15-9-10-16-29-26/h4-16,24H,17-21H2,1-3H3/t24-/m1/s1 |
| InChIKey | ZDPFEKCHLKYHAW-XMMPIXPASA-N |
| XLogP | 5.41 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |