C14H26F2 — CID 91135267
1,4-bis(2-fluorobutyl)cyclohexane (PubChem CID 91135267) has the molecular formula C14H26F2 and a molecular weight of 232.36 g/mol. Its IUPAC name is 1,4-bis(2-fluorobutyl)cyclohexane.
| Compound Name | 1,4-bis(2-fluorobutyl)cyclohexane |
|---|---|
| PubChem CID | 91135267 |
| Molecular Formula | C14H26F2 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1,4-bis(2-fluorobutyl)cyclohexane |
| SMILES | CCC(F)CC1CCC(CC(F)CC)CC1 |
| InChI | InChI=1S/C14H26F2/c1-3-13(15)9-11-5-7-12(8-6-11)10-14(16)4-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | UAEQXKGJPASFGP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |