About 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline
5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline (PubChem CID 91137046) has the molecular formula C23H20N4
and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline.
Molecular Properties
| Compound Name | 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline |
| PubChem CID | 91137046 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline |
| SMILES | C[C@H](c1ccccc1)N1CNc2ccc(-c3cccc4ncccc34)nc21 |
| InChI | InChI=1S/C23H20N4/c1-16(17-7-3-2-4-8-17)27-15-25-22-13-12-21(26-23(22)27)19-9-5-11-20-18(19)10-6-14-24-20/h2-14,16,25H,15H2,1H3/t16-/m1/s1 |
| InChIKey | XGDXFOKRKFKTCZ-MRXNPFEDSA-N |
| XLogP | 5.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline?
The IUPAC name of 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline (CID 91137046) is 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline.
What is the SMILES notation for 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline?
The canonical SMILES for 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline is C[C@H](c1ccccc1)N1CNc2ccc(-c3cccc4ncccc34)nc21.
What is the InChIKey of 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline?
The InChIKey is XGDXFOKRKFKTCZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C23H20N4/c1-16(17-7-3-2-4-8-17)27-15-25-22-13-12-21(26-23(22)27)19-9-5-11-20-18(19)10-6-14-24-20/h2-14,16,25H,15H2,1H3/t16-/m1/s1.
What are the key properties of 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline?
5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline has a molecular weight of 352.44 g/mol, XLogP of 5.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-b]pyridin-5-yl]quinoline is sourced from PubChem (CID 91137046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).