C14H22O2 — CID 91138214
(3S,4aR,5S,8aS)-3-ethyl-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione (PubChem CID 91138214) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3S,4aR,5S,8aS)-3-ethyl-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione.
| Compound Name | (3S,4aR,5S,8aS)-3-ethyl-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione |
|---|---|
| PubChem CID | 91138214 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3S,4aR,5S,8aS)-3-ethyl-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione |
| SMILES | CC[C@H]1C[C@@]2(C)[C@H](CCC[C@@H]2C)C(=O)C1=O |
| InChI | InChI=1S/C14H22O2/c1-4-10-8-14(3)9(2)6-5-7-11(14)13(16)12(10)15/h9-11H,4-8H2,1-3H3/t9-,10-,11+,14+/m0/s1 |
| InChIKey | OAMLHLDSOZBENW-KZWBYHQPSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|