C17H28O2 — CID 90749747
4a,5-dimethyl-3-(3-methylbutan-2-yl)-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione (PubChem CID 90749747) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 4a,5-dimethyl-3-(3-methylbutan-2-yl)-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione.
| Compound Name | 4a,5-dimethyl-3-(3-methylbutan-2-yl)-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione |
|---|---|
| PubChem CID | 90749747 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4a,5-dimethyl-3-(3-methylbutan-2-yl)-4,5,6,7,8,8a-hexahydro-3H-naphthalene-1,2-dione |
| SMILES | CC(C)C(C)C1CC2(C)C(C)CCCC2C(=O)C1=O |
| InChI | InChI=1S/C17H28O2/c1-10(2)12(4)13-9-17(5)11(3)7-6-8-14(17)16(19)15(13)18/h10-14H,6-9H2,1-5H3 |
| InChIKey | KKSPNWQKFWMQLS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|