C23H32N2O2 — CID 9114061
3-[[2-(1-adamantyl)acetyl]amino]-N,N-diethylbenzamide (PubChem CID 9114061) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-[[2-(1-adamantyl)acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-(1-adamantyl)acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 9114061 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-[[2-(1-adamantyl)acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H32N2O2/c1-3-25(4-2)22(27)19-6-5-7-20(11-19)24-21(26)15-23-12-16-8-17(13-23)10-18(9-16)14-23/h5-7,11,16-18H,3-4,8-10,12-15H2,1-2H3,(H,24,26) |
| InChIKey | QUTVJTMIIPPSPU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |