C10H18N2O11S3 — CID 91141334
2,5-dihydroxy-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,3,4,5,6,7-hexahydrothiopyrano[2,3-b]thiopyran-6-sulfonamide (PubChem CID 91141334) has the molecular formula C10H18N2O11S3 and a molecular weight of 438.46 g/mol. Its IUPAC name is 2,5-dihydroxy-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,3,4,5,6,7-hexahydrothiopyrano[2,3-b]thiopyran-6-sulfonamide.
| Compound Name | 2,5-dihydroxy-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,3,4,5,6,7-hexahydrothiopyrano[2,3-b]thiopyran-6-sulfonamide |
|---|---|
| PubChem CID | 91141334 |
| Molecular Formula | C10H18N2O11S3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 2,5-dihydroxy-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,3,4,5,6,7-hexahydrothiopyrano[2,3-b]thiopyran-6-sulfonamide |
| SMILES | NS(=O)(=O)C1CSC2=C(C(NC(O)(O)C(O)(O)O)CC(O)S2(=O)=O)C1O |
| InChI | InChI=1S/C10H18N2O11S3/c11-26(22,23)4-2-24-8-6(7(4)14)3(1-5(13)25(8,20)21)12-9(15,16)10(17,18)19/h3-5,7,12-19H,1-2H2,(H2,11,22,23) |
| InChIKey | DWRKFIMEPIDWAE-UHFFFAOYSA-N |
| XLogP | -5.67 |
| TPSA | 247.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|