C10H20N2O12S3 — CID 91114441
2-[3,3-dihydroxy-6-methylsulfanyl-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,4-dihydrothiopyran-5-yl]-2-hydroxyethanesulfonamide (PubChem CID 91114441) has the molecular formula C10H20N2O12S3 and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[3,3-dihydroxy-6-methylsulfanyl-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,4-dihydrothiopyran-5-yl]-2-hydroxyethanesulfonamide.
| Compound Name | 2-[3,3-dihydroxy-6-methylsulfanyl-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,4-dihydrothiopyran-5-yl]-2-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 91114441 |
| Molecular Formula | C10H20N2O12S3 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-[3,3-dihydroxy-6-methylsulfanyl-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-2,4-dihydrothiopyran-5-yl]-2-hydroxyethanesulfonamide |
| SMILES | CSC1=C(C(O)CS(N)(=O)=O)C(NC(O)(O)C(O)(O)O)C(O)(O)CS1(=O)=O |
| InChI | InChI=1S/C10H20N2O12S3/c1-25-7-5(4(13)2-27(11,23)24)6(8(14,15)3-26(7,21)22)12-9(16,17)10(18,19)20/h4,6,12-20H,2-3H2,1H3,(H2,11,23,24) |
| InChIKey | URAAXIKQNTWSRL-UHFFFAOYSA-N |
| XLogP | -6.45 |
| TPSA | 268.17 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | -6.45 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|