C11H20N2O10S3 — CID 91081882
1-[[5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide (PubChem CID 91081882) has the molecular formula C11H20N2O10S3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-[[5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 91081882 |
| Molecular Formula | C11H20N2O10S3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 1-[[5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(C)C(NCC(O)(O)O)C(O)(O)C(C)(O)S1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C11H20N2O10S3/c1-5-7(13-4-10(15,16)17)11(18,19)9(3,14)25(20,21)8(5)24-6(2)26(12,22)23/h7,13-19H,2,4H2,1,3H3,(H2,12,22,23) |
| InChIKey | OKWYOOXNQSOPHY-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 227.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|