C11H20N2O9S3 — CID 91050293
1-[[4-(1,1-dihydroxyethylamino)-5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide (PubChem CID 91050293) has the molecular formula C11H20N2O9S3 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[[4-(1,1-dihydroxyethylamino)-5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[4-(1,1-dihydroxyethylamino)-5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 91050293 |
| Molecular Formula | C11H20N2O9S3 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-[[4-(1,1-dihydroxyethylamino)-5,5,6-trihydroxy-3,6-dimethyl-1,1-dioxo-4H-thiopyran-2-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(C)C(NC(C)(O)O)C(O)(O)C(C)(O)S1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C11H20N2O9S3/c1-5-7(13-10(4,15)16)11(17,18)9(3,14)24(19,20)8(5)23-6(2)25(12,21)22/h7,13-18H,2H2,1,3-4H3,(H2,12,21,22) |
| InChIKey | BTCGAHMKQYEXQY-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|