C11H20N2O9S3 — CID 90742842
1-[[5-ethyl-3,3-dihydroxy-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide (PubChem CID 90742842) has the molecular formula C11H20N2O9S3 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[[5-ethyl-3,3-dihydroxy-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[5-ethyl-3,3-dihydroxy-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 90742842 |
| Molecular Formula | C11H20N2O9S3 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-[[5-ethyl-3,3-dihydroxy-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(CC)C(NCC(O)(O)O)C(O)(O)CS1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C11H20N2O9S3/c1-3-7-8(13-4-11(16,17)18)10(14,15)5-24(19,20)9(7)23-6(2)25(12,21)22/h8,13-18H,2-5H2,1H3,(H2,12,21,22) |
| InChIKey | IKOCVLDORJEVAY-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|