C11H20N2O7S3 — CID 91500251
1-[[2,5-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide (PubChem CID 91500251) has the molecular formula C11H20N2O7S3 and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[2,5-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 91500251 |
| Molecular Formula | C11H20N2O7S3 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-[[2,5-dimethyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(C)C(NCC(O)(O)O)CC(C)S1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C11H20N2O7S3/c1-6-4-9(13-5-11(14,15)16)7(2)10(22(6,17)18)21-8(3)23(12,19)20/h6,9,13-16H,3-5H2,1-2H3,(H2,12,19,20) |
| InChIKey | VLYVFWGKKDIQBN-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|