C9H18N2O9S3 — CID 90831178
3-(1,1,2,2,2-pentahydroxyethylamino)-3-(2-sulfamoyl-2,3-dihydrothiophen-4-yl)propane-1-sulfinic acid (PubChem CID 90831178) has the molecular formula C9H18N2O9S3 and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentahydroxyethylamino)-3-(2-sulfamoyl-2,3-dihydrothiophen-4-yl)propane-1-sulfinic acid.
| Compound Name | 3-(1,1,2,2,2-pentahydroxyethylamino)-3-(2-sulfamoyl-2,3-dihydrothiophen-4-yl)propane-1-sulfinic acid |
|---|---|
| PubChem CID | 90831178 |
| Molecular Formula | C9H18N2O9S3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 3-(1,1,2,2,2-pentahydroxyethylamino)-3-(2-sulfamoyl-2,3-dihydrothiophen-4-yl)propane-1-sulfinic acid |
| SMILES | NS(=O)(=O)C1CC(C(CCS(=O)O)NC(O)(O)C(O)(O)O)=CS1 |
| InChI | InChI=1S/C9H18N2O9S3/c10-23(19,20)7-3-5(4-21-7)6(1-2-22(17)18)11-8(12,13)9(14,15)16/h4,6-7,11-16H,1-3H2,(H,17,18)(H2,10,19,20) |
| InChIKey | GQLFTOLXUJWYLQ-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 210.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|