C9H16N2O7S3 — CID 90951011
7,7-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 90951011) has the molecular formula C9H16N2O7S3 and a molecular weight of 360.44 g/mol. Its IUPAC name is 7,7-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 7,7-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 90951011 |
| Molecular Formula | C9H16N2O7S3 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 7,7-dioxo-4-(2,2,2-trihydroxyethylamino)-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | NS(=O)(=O)C1CC2=C(S1)S(=O)(=O)CCC2NCC(O)(O)O |
| InChI | InChI=1S/C9H16N2O7S3/c10-21(17,18)7-3-5-6(11-4-9(12,13)14)1-2-20(15,16)8(5)19-7/h6-7,11-14H,1-4H2,(H2,10,17,18) |
| InChIKey | XTPZKWAXAMRZIW-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|