C11H20N2O4S3 — CID 90806174
4-(ethylamino)-N,6-dimethyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 90806174) has the molecular formula C11H20N2O4S3 and a molecular weight of 340.49 g/mol. Its IUPAC name is 4-(ethylamino)-N,6-dimethyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 4-(ethylamino)-N,6-dimethyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 90806174 |
| Molecular Formula | C11H20N2O4S3 |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-(ethylamino)-N,6-dimethyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCNC1CC(C)S(=O)(=O)C2=C1CC(S(=O)(=O)NC)S2 |
| InChI | InChI=1S/C11H20N2O4S3/c1-4-13-9-5-7(2)19(14,15)11-8(9)6-10(18-11)20(16,17)12-3/h7,9-10,12-13H,4-6H2,1-3H3 |
| InChIKey | KHITZCULEQIISA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |