C15H30N2O4S3 — CID 123660742
4-(ethylamino)-1,1,6-trimethyl-7,7-dioxo-1-propyl-3,4,5,6-tetrahydrothieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 123660742) has the molecular formula C15H30N2O4S3 and a molecular weight of 398.62 g/mol. Its IUPAC name is 4-(ethylamino)-1,1,6-trimethyl-7,7-dioxo-1-propyl-3,4,5,6-tetrahydrothieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 4-(ethylamino)-1,1,6-trimethyl-7,7-dioxo-1-propyl-3,4,5,6-tetrahydrothieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 123660742 |
| Molecular Formula | C15H30N2O4S3 |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-(ethylamino)-1,1,6-trimethyl-7,7-dioxo-1-propyl-3,4,5,6-tetrahydrothieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCCS1(C)(C)=C(S(N)(=O)=O)CC2=C1S(=O)(=O)C(C)CC2NCC |
| InChI | InChI=1S/C15H30N2O4S3/c1-6-8-24(4,5)14(23(16,20)21)10-12-13(17-7-2)9-11(3)22(18,19)15(12)24/h11,13,17H,6-10H2,1-5H3,(H2,16,20,21) |
| InChIKey | JALMDOPKKOHNRR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|