C11H18N2O4S3 — CID 123446376
5-(ethylamino)-7-methyl-8,8-dioxo-4,5,6,7-tetrahydrothiopyrano[2,3-b]thiopyran-2-sulfonamide (PubChem CID 123446376) has the molecular formula C11H18N2O4S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 5-(ethylamino)-7-methyl-8,8-dioxo-4,5,6,7-tetrahydrothiopyrano[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 5-(ethylamino)-7-methyl-8,8-dioxo-4,5,6,7-tetrahydrothiopyrano[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 123446376 |
| Molecular Formula | C11H18N2O4S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-(ethylamino)-7-methyl-8,8-dioxo-4,5,6,7-tetrahydrothiopyrano[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCNC1CC(C)S(=O)(=O)C2=C1CC=C(S(N)(=O)=O)S2 |
| InChI | InChI=1S/C11H18N2O4S3/c1-3-13-9-6-7(2)19(14,15)11-8(9)4-5-10(18-11)20(12,16)17/h5,7,9,13H,3-4,6H2,1-2H3,(H2,12,16,17) |
| InChIKey | YFOVRHHVMDYBBE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |