C10H18N2O9S3 — CID 91439864
1-[[3,3-dihydroxy-5-methyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide (PubChem CID 91439864) has the molecular formula C10H18N2O9S3 and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[[3,3-dihydroxy-5-methyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[3,3-dihydroxy-5-methyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 91439864 |
| Molecular Formula | C10H18N2O9S3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 1-[[3,3-dihydroxy-5-methyl-1,1-dioxo-4-(2,2,2-trihydroxyethylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(C)C(NCC(O)(O)O)C(O)(O)CS1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C10H18N2O9S3/c1-5-7(12-3-10(15,16)17)9(13,14)4-23(18,19)8(5)22-6(2)24(11,20)21/h7,12-17H,2-4H2,1H3,(H2,11,20,21) |
| InChIKey | JRDJKKJOHXWAAO-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|