C8H16N2O6S3 — CID 91530012
5,5-dihydroxy-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide (PubChem CID 91530012) has the molecular formula C8H16N2O6S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is 5,5-dihydroxy-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide.
| Compound Name | 5,5-dihydroxy-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide |
|---|---|
| PubChem CID | 91530012 |
| Molecular Formula | C8H16N2O6S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5,5-dihydroxy-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide |
| SMILES | CNC1CC=C(S(N)(=O)=O)SCS(=O)(=O)CC1(O)O |
| InChI | InChI=1S/C8H16N2O6S3/c1-10-6-2-3-7(19(9,15)16)17-5-18(13,14)4-8(6,11)12/h3,6,10-12H,2,4-5H2,1H3,(H2,9,15,16) |
| InChIKey | LTSXRLORWMDELK-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|