C9H18N2O6S3 — CID 91352732
5,5-dihydroxy-2-methyl-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide (PubChem CID 91352732) has the molecular formula C9H18N2O6S3 and a molecular weight of 346.45 g/mol. Its IUPAC name is 5,5-dihydroxy-2-methyl-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide.
| Compound Name | 5,5-dihydroxy-2-methyl-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide |
|---|---|
| PubChem CID | 91352732 |
| Molecular Formula | C9H18N2O6S3 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5,5-dihydroxy-2-methyl-6-(methylamino)-3,3-dioxo-6,7-dihydro-4H-1,3-dithionine-9-sulfonamide |
| SMILES | CNC1CC=C(S(N)(=O)=O)SC(C)S(=O)(=O)CC1(O)O |
| InChI | InChI=1S/C9H18N2O6S3/c1-6-18-8(20(10,16)17)4-3-7(11-2)9(12,13)5-19(6,14)15/h4,6-7,11-13H,3,5H2,1-2H3,(H2,10,16,17) |
| InChIKey | QHSQJRQJWMSWQM-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|