C10H18N2O10S3 — CID 91328296
1-[[5-(hydroxymethyl)-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide (PubChem CID 91328296) has the molecular formula C10H18N2O10S3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-[[5-(hydroxymethyl)-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide.
| Compound Name | 1-[[5-(hydroxymethyl)-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide |
|---|---|
| PubChem CID | 91328296 |
| Molecular Formula | C10H18N2O10S3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 1-[[5-(hydroxymethyl)-1,1-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-3,4-dihydro-2H-thiopyran-6-yl]sulfanyl]ethenesulfonamide |
| SMILES | C=C(SC1=C(CO)C(NC(O)(O)C(O)(O)O)CCS1(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C10H18N2O10S3/c1-5(25(11,21)22)23-8-6(4-13)7(2-3-24(8,19)20)12-9(14,15)10(16,17)18/h7,12-18H,1-4H2,(H2,11,21,22) |
| InChIKey | CHDJWTNWHSKEQQ-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 227.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|