C12H24N2O11S3 — CID 91181901
1-[[3,3-dihydroxy-5-(methoxymethyl)-1,1-dioxo-4-(1,1,1,2-tetrahydroxypropan-2-ylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethanesulfonamide (PubChem CID 91181901) has the molecular formula C12H24N2O11S3 and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[[3,3-dihydroxy-5-(methoxymethyl)-1,1-dioxo-4-(1,1,1,2-tetrahydroxypropan-2-ylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethanesulfonamide.
| Compound Name | 1-[[3,3-dihydroxy-5-(methoxymethyl)-1,1-dioxo-4-(1,1,1,2-tetrahydroxypropan-2-ylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethanesulfonamide |
|---|---|
| PubChem CID | 91181901 |
| Molecular Formula | C12H24N2O11S3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 1-[[3,3-dihydroxy-5-(methoxymethyl)-1,1-dioxo-4-(1,1,1,2-tetrahydroxypropan-2-ylamino)-2,4-dihydrothiopyran-6-yl]sulfanyl]ethanesulfonamide |
| SMILES | COCC1=C(SC(C)S(N)(=O)=O)S(=O)(=O)CC(O)(O)C1NC(C)(O)C(O)(O)O |
| InChI | InChI=1S/C12H24N2O11S3/c1-6(28(13,23)24)26-9-7(4-25-3)8(11(16,17)5-27(9,21)22)14-10(2,15)12(18,19)20/h6,8,14-20H,4-5H2,1-3H3,(H2,13,23,24) |
| InChIKey | RHXBKDNAOSRSHQ-UHFFFAOYSA-N |
| XLogP | -4.38 |
| TPSA | 236.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|