C21H32O4S — CID 91143014
methyl 7-[(1R)-5-oxo-2-(3-oxooctyl)-3-sulfanylidenecyclopentyl]hept-5-enoate (PubChem CID 91143014) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is methyl 7-[(1R)-5-oxo-2-(3-oxooctyl)-3-sulfanylidenecyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R)-5-oxo-2-(3-oxooctyl)-3-sulfanylidenecyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91143014 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | methyl 7-[(1R)-5-oxo-2-(3-oxooctyl)-3-sulfanylidenecyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)CCC1C(=S)CC(=O)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C21H32O4S/c1-3-4-7-10-16(22)13-14-18-17(19(23)15-20(18)26)11-8-5-6-9-12-21(24)25-2/h5,8,17-18H,3-4,6-7,9-15H2,1-2H3/t17-,18?/m1/s1 |
| InChIKey | IAVNBFBYRXTVPE-QNSVNVJESA-N |
| XLogP | 4.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|