C26H30F2N6O — CID 91144568
N-[10-(3,4-difluorophenyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[1,5-a]azocin-2-yl]-3-methoxy-4-(4-methylimidazol-1-yl)cyclohept-2-en-1-imine (PubChem CID 91144568) has the molecular formula C26H30F2N6O and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[10-(3,4-difluorophenyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[1,5-a]azocin-2-yl]-3-methoxy-4-(4-methylimidazol-1-yl)cyclohept-2-en-1-imine.
| Compound Name | N-[10-(3,4-difluorophenyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[1,5-a]azocin-2-yl]-3-methoxy-4-(4-methylimidazol-1-yl)cyclohept-2-en-1-imine |
|---|---|
| PubChem CID | 91144568 |
| Molecular Formula | C26H30F2N6O |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-[10-(3,4-difluorophenyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[1,5-a]azocin-2-yl]-3-methoxy-4-(4-methylimidazol-1-yl)cyclohept-2-en-1-imine |
| SMILES | COC1=CC(=Nc2nc3n(n2)CCCCCC3c2ccc(F)c(F)c2)CCCC1n1cnc(C)c1 |
| InChI | InChI=1S/C26H30F2N6O/c1-17-15-33(16-29-17)23-9-6-7-19(14-24(23)35-2)30-26-31-25-20(8-4-3-5-12-34(25)32-26)18-10-11-21(27)22(28)13-18/h10-11,13-16,20,23H,3-9,12H2,1-2H3 |
| InChIKey | XIOGIFWIGRAADU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|