About pyrimido[1,2-c]pyrimidin-7-ium
pyrimido[1,2-c]pyrimidin-7-ium (PubChem CID 91144617) has the molecular formula C7H6N3+
and a molecular weight of 132.15 g/mol. Its IUPAC name is pyrimido[1,2-c]pyrimidin-7-ium.
Molecular Properties
| Compound Name | pyrimido[1,2-c]pyrimidin-7-ium |
| PubChem CID | 91144617 |
| Molecular Formula | C7H6N3+ |
| Molecular Weight | 132.15 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | pyrimido[1,2-c]pyrimidin-7-ium |
| SMILES | C1=CN2C=[N+]=CC=C2N=C1 |
| InChI | InChI=1S/C7H6N3/c1-3-9-7-2-4-8-6-10(7)5-1/h1-6H/q+1 |
| InChIKey | FHMXCBZPAVGCJE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze pyrimido[1,2-c]pyrimidin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[1,2-c]pyrimidin-7-ium?
The IUPAC name of pyrimido[1,2-c]pyrimidin-7-ium (CID 91144617) is pyrimido[1,2-c]pyrimidin-7-ium.
What is the SMILES notation for pyrimido[1,2-c]pyrimidin-7-ium?
The canonical SMILES for pyrimido[1,2-c]pyrimidin-7-ium is C1=CN2C=[N+]=CC=C2N=C1.
What is the InChIKey of pyrimido[1,2-c]pyrimidin-7-ium?
The InChIKey is FHMXCBZPAVGCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N3/c1-3-9-7-2-4-8-6-10(7)5-1/h1-6H/q+1.
What are the key properties of pyrimido[1,2-c]pyrimidin-7-ium?
pyrimido[1,2-c]pyrimidin-7-ium has a molecular weight of 132.15 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[1,2-c]pyrimidin-7-ium is sourced from PubChem (CID 91144617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).