C13H21N4O4S- — CID 9114467
(2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoate (PubChem CID 9114467) has the molecular formula C13H21N4O4S- and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoate.
| Compound Name | (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 9114467 |
| Molecular Formula | C13H21N4O4S- |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoate |
| SMILES | COCCCn1cnnc1SCC(=O)N[C@H](C(=O)[O-])C(C)C |
| InChI | InChI=1S/C13H22N4O4S/c1-9(2)11(12(19)20)15-10(18)7-22-13-16-14-8-17(13)5-4-6-21-3/h8-9,11H,4-7H2,1-3H3,(H,15,18)(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | AQGDHZXDYGBNOQ-NSHDSACASA-M |
| XLogP | -0.70 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|