C13H22N4O4S — CID 9114468
(2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoic acid (PubChem CID 9114468) has the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 9114468 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2S)-2-[[2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-methylbutanoic acid |
| SMILES | COCCCn1cnnc1SCC(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C13H22N4O4S/c1-9(2)11(12(19)20)15-10(18)7-22-13-16-14-8-17(13)5-4-6-21-3/h8-9,11H,4-7H2,1-3H3,(H,15,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | AQGDHZXDYGBNOQ-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|