C13H9ClIN3O2S — CID 91144672
5-[(2-chloro-4-iodo-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91144672) has the molecular formula C13H9ClIN3O2S and a molecular weight of 433.66 g/mol. Its IUPAC name is 5-[(2-chloro-4-iodo-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2-chloro-4-iodo-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91144672 |
| Molecular Formula | C13H9ClIN3O2S |
| Molecular Weight | 433.66 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 5-[(2-chloro-4-iodo-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2c(I)ccnc2Cl)C(=O)NC1=S |
| InChI | InChI=1S/C13H9ClIN3O2S/c1-2-5-18-12(20)8(11(19)17-13(18)21)6-7-9(15)3-4-16-10(7)14/h2-4,6H,1,5H2,(H,17,19,21) |
| InChIKey | QKDNTAGYCZWIFG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.66 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|