C7H12N2O2 — CID 91145432
1-(3-aminopropyl)pyrrole-2,5-diol (PubChem CID 91145432) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-(3-aminopropyl)pyrrole-2,5-diol.
| Compound Name | 1-(3-aminopropyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91145432 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-(3-aminopropyl)pyrrole-2,5-diol |
| SMILES | NCCCn1c(O)ccc1O |
| InChI | InChI=1S/C7H12N2O2/c8-4-1-5-9-6(10)2-3-7(9)11/h2-3,10-11H,1,4-5,8H2 |
| InChIKey | SHXPYCNUVXEBNT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |