C13H15N3S2 — CID 9114655
5-(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentanenitrile (PubChem CID 9114655) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is 5-(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentanenitrile.
| Compound Name | 5-(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentanenitrile |
|---|---|
| PubChem CID | 9114655 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentanenitrile |
| SMILES | CCc1cc2c(SCCCCC#N)ncnc2s1 |
| InChI | InChI=1S/C13H15N3S2/c1-2-10-8-11-12(15-9-16-13(11)18-10)17-7-5-3-4-6-14/h8-9H,2-5,7H2,1H3 |
| InChIKey | UITDEUPCPVEUPU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|