C15H19BrO2S — CID 91146571
(7R)-7-[(4-bromophenyl)sulfanylmethyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 91146571) has the molecular formula C15H19BrO2S and a molecular weight of 343.29 g/mol. Its IUPAC name is (7R)-7-[(4-bromophenyl)sulfanylmethyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7R)-7-[(4-bromophenyl)sulfanylmethyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 91146571 |
| Molecular Formula | C15H19BrO2S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (7R)-7-[(4-bromophenyl)sulfanylmethyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | Brc1ccc(SC[C@@H]2CCCC3(C2)OCCO3)cc1 |
| InChI | InChI=1S/C15H19BrO2S/c16-13-3-5-14(6-4-13)19-11-12-2-1-7-15(10-12)17-8-9-18-15/h3-6,12H,1-2,7-11H2/t12-/m1/s1 |
| InChIKey | JPWJPAWJQLHSHV-GFCCVEGCSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |