C21H25F2N3O2 — CID 91146687
2-[3-[4-(2,4-difluorophenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 91146687) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[3-[4-(2,4-difluorophenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3-[4-(2,4-difluorophenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91146687 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[3-[4-(2,4-difluorophenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(c3ccc(F)cc3F)CC1)CC=CC2 |
| InChI | InChI=1S/C21H25F2N3O2/c22-15-6-7-19(18(23)14-15)25-12-10-24(11-13-25)8-3-9-26-20(27)16-4-1-2-5-17(16)21(26)28/h1-2,6-7,14,27-28H,3-5,8-13H2 |
| InChIKey | LQOZFRORHALBAI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|