C15H14N2O5 — CID 91146907
4-[4-[(4-methoxyphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid (PubChem CID 91146907) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-[4-[(4-methoxyphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[4-[(4-methoxyphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 91146907 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[4-[(4-methoxyphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid |
| SMILES | COc1ccc(Cc2cn[nH]c2C(=O)CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O5/c1-22-11-4-2-9(3-5-11)6-10-8-16-17-14(10)12(18)7-13(19)15(20)21/h2-5,8H,6-7H2,1H3,(H,16,17)(H,20,21) |
| InChIKey | MWTFXSOUBRRLHB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|