C15H14N2O4 — CID 90833893
4-[4-[(4-methylphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid (PubChem CID 90833893) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-[4-[(4-methylphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[4-[(4-methylphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 90833893 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[4-[(4-methylphenyl)methyl]-1H-pyrazol-5-yl]-2,4-dioxobutanoic acid |
| SMILES | Cc1ccc(Cc2cn[nH]c2C(=O)CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O4/c1-9-2-4-10(5-3-9)6-11-8-16-17-14(11)12(18)7-13(19)15(20)21/h2-5,8H,6-7H2,1H3,(H,16,17)(H,20,21) |
| InChIKey | WSKCYYQOAZYRPY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|