C19H21ClN2O3 — CID 9114738
6-chloro-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]pyridine-3-carboxamide (PubChem CID 9114738) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 6-chloro-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9114738 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 6-chloro-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]pyridine-3-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(Cl)nc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H21ClN2O3/c1-12(2)18(22-19(23)14-5-7-17(20)21-11-14)13-4-6-15-16(10-13)25-9-3-8-24-15/h4-7,10-12,18H,3,8-9H2,1-2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | IUSJPGCDONVIDL-GOSISDBHSA-N |
| XLogP | 4.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|