C24H32O4 — CID 91147800
(10S,13S,17R)-7-acetyl-10,13-dimethylspiro[2,4,5,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 91147800) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (10S,13S,17R)-7-acetyl-10,13-dimethylspiro[2,4,5,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (10S,13S,17R)-7-acetyl-10,13-dimethylspiro[2,4,5,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 91147800 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (10S,13S,17R)-7-acetyl-10,13-dimethylspiro[2,4,5,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | CC(=O)C1=CC2CC(=O)CC[C@]2(C)C2CC[C@@]3(C)C(CC[C@@]34CCC(=O)O4)C12 |
| InChI | InChI=1S/C24H32O4/c1-14(25)17-13-15-12-16(26)4-8-22(15,2)18-5-9-23(3)19(21(17)18)6-10-24(23)11-7-20(27)28-24/h13,15,18-19,21H,4-12H2,1-3H3/t15?,18?,19?,21?,22-,23-,24+/m0/s1 |
| InChIKey | KVZXXMFEMHNQKF-DIJLSCIPSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |