C23H30O4 — CID 122683360
(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-5',7-dioxospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-3-carbaldehyde (PubChem CID 122683360) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-5',7-dioxospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-3-carbaldehyde.
| Compound Name | (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-5',7-dioxospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-3-carbaldehyde |
|---|---|
| PubChem CID | 122683360 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-5',7-dioxospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-3-carbaldehyde |
| SMILES | C[C@]12CC[C@H](C=O)CC1=CC(=O)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C23H30O4/c1-21-7-3-14(13-24)11-15(21)12-18(25)20-16(21)4-8-22(2)17(20)5-9-23(22)10-6-19(26)27-23/h12-14,16-17,20H,3-11H2,1-2H3/t14-,16-,17-,20+,21-,22-,23+/m0/s1 |
| InChIKey | HGKZKPJPEPHMLC-OYYOCINNSA-N |
| XLogP | 4.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|