C24H32O5S — CID 78426519
S-[(2R,7R,8R,9S,10R,13S,14S,17R)-2-hydroxy-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate (PubChem CID 78426519) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is S-[(2R,7R,8R,9S,10R,13S,14S,17R)-2-hydroxy-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate.
| Compound Name | S-[(2R,7R,8R,9S,10R,13S,14S,17R)-2-hydroxy-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
|---|---|
| PubChem CID | 78426519 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | S-[(2R,7R,8R,9S,10R,13S,14S,17R)-2-hydroxy-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CC2=CC(=O)[C@H](O)C[C@]2(C)[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]34CCC(=O)O4)[C@H]12 |
| InChI | InChI=1S/C24H32O5S/c1-13(25)30-19-11-14-10-17(26)18(27)12-22(14,2)15-4-7-23(3)16(21(15)19)5-8-24(23)9-6-20(28)29-24/h10,15-16,18-19,21,27H,4-9,11-12H2,1-3H3/t15-,16-,18+,19+,21+,22-,23-,24+/m0/s1 |
| InChIKey | RWMKWBGAXPSXIX-IHODQYHISA-N |
| XLogP | 3.82 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|