C25H36O3S — CID 142810064
S-[(7R,17R)-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxane]-7-yl] ethanethioate (PubChem CID 142810064) has the molecular formula C25H36O3S and a molecular weight of 416.63 g/mol. Its IUPAC name is S-[(7R,17R)-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxane]-7-yl] ethanethioate.
| Compound Name | S-[(7R,17R)-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxane]-7-yl] ethanethioate |
|---|---|
| PubChem CID | 142810064 |
| Molecular Formula | C25H36O3S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | S-[(7R,17R)-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxane]-7-yl] ethanethioate |
| SMILES | CC(=O)SC1CC2=CCCCC2(C)C2CCC3(C)C(CC[C@@]34CCC(=O)CO4)C12 |
| InChI | InChI=1S/C25H36O3S/c1-16(26)29-21-14-17-6-4-5-10-23(17,2)19-8-11-24(3)20(22(19)21)9-13-25(24)12-7-18(27)15-28-25/h6,19-22H,4-5,7-15H2,1-3H3/t19?,20?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | WGVRJFRZIZYFSH-JIDABFMYSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|