About 1-hydrazinylpyrrole-2,5-diol
1-hydrazinylpyrrole-2,5-diol (PubChem CID 91148052) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is 1-hydrazinylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-hydrazinylpyrrole-2,5-diol |
| PubChem CID | 91148052 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 1-hydrazinylpyrrole-2,5-diol |
| SMILES | NNn1c(O)ccc1O |
| InChI | InChI=1S/C4H7N3O2/c5-6-7-3(8)1-2-4(7)9/h1-2,6,8-9H,5H2 |
| InChIKey | BIBRPQZDOXUBOR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinylpyrrole-2,5-diol?
The IUPAC name of 1-hydrazinylpyrrole-2,5-diol (CID 91148052) is 1-hydrazinylpyrrole-2,5-diol.
What is the SMILES notation for 1-hydrazinylpyrrole-2,5-diol?
The canonical SMILES for 1-hydrazinylpyrrole-2,5-diol is NNn1c(O)ccc1O.
What is the InChIKey of 1-hydrazinylpyrrole-2,5-diol?
The InChIKey is BIBRPQZDOXUBOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2/c5-6-7-3(8)1-2-4(7)9/h1-2,6,8-9H,5H2.
What are the key properties of 1-hydrazinylpyrrole-2,5-diol?
1-hydrazinylpyrrole-2,5-diol has a molecular weight of 129.12 g/mol, XLogP of -0.68, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinylpyrrole-2,5-diol is sourced from PubChem (CID 91148052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).