C12H21NO5 — CID 91148866
ethyl (1R,2R,5S,6S,8S,8aR)-1,2,8-trihydroxy-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate (PubChem CID 91148866) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,8S,8aR)-1,2,8-trihydroxy-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,8S,8aR)-1,2,8-trihydroxy-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate |
|---|---|
| PubChem CID | 91148866 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | ethyl (1R,2R,5S,6S,8S,8aR)-1,2,8-trihydroxy-5-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](O)[C@@H]2[C@@H](O)[C@H](O)CN2[C@H]1C |
| InChI | InChI=1S/C12H21NO5/c1-3-18-12(17)7-4-8(14)10-11(16)9(15)5-13(10)6(7)2/h6-11,14-16H,3-5H2,1-2H3/t6-,7-,8-,9+,10+,11-/m0/s1 |
| InChIKey | HHQLXARWNYRPKW-UDLFHZNPSA-N |
| XLogP | -1.28 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |