C33H37Cl4N3O3S — CID 91148880
4-(2-butoxy-5-octylphenyl)sulfanyl-5-(2-chloro-5-hydroxyanilino)-2-(2,4,6-trichlorophenyl)-1H-pyrazol-3-one (PubChem CID 91148880) has the molecular formula C33H37Cl4N3O3S and a molecular weight of 697.56 g/mol. Its IUPAC name is 4-(2-butoxy-5-octylphenyl)sulfanyl-5-(2-chloro-5-hydroxyanilino)-2-(2,4,6-trichlorophenyl)-1H-pyrazol-3-one.
| Compound Name | 4-(2-butoxy-5-octylphenyl)sulfanyl-5-(2-chloro-5-hydroxyanilino)-2-(2,4,6-trichlorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 91148880 |
| Molecular Formula | C33H37Cl4N3O3S |
| Molecular Weight | 697.56 g/mol |
| Exact Mass | 695.13 |
| IUPAC Name | 4-(2-butoxy-5-octylphenyl)sulfanyl-5-(2-chloro-5-hydroxyanilino)-2-(2,4,6-trichlorophenyl)-1H-pyrazol-3-one |
| SMILES | CCCCCCCCc1ccc(OCCCC)c(Sc2c(Nc3cc(O)ccc3Cl)[nH]n(-c3c(Cl)cc(Cl)cc3Cl)c2=O)c1 |
| InChI | InChI=1S/C33H37Cl4N3O3S/c1-3-5-7-8-9-10-11-21-12-15-28(43-16-6-4-2)29(17-21)44-31-32(38-27-20-23(41)13-14-24(27)35)39-40(33(31)42)30-25(36)18-22(34)19-26(30)37/h12-15,17-20,38-39,41H,3-11,16H2,1-2H3 |
| InChIKey | HYKXUIUPFQATLS-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.56 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|