C9H11N3 — CID 91150477
1,4,4a,5-tetrahydroquinazolin-2-ylmethanimine (PubChem CID 91150477) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,4,4a,5-tetrahydroquinazolin-2-ylmethanimine.
| Compound Name | 1,4,4a,5-tetrahydroquinazolin-2-ylmethanimine |
|---|---|
| PubChem CID | 91150477 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1,4,4a,5-tetrahydroquinazolin-2-ylmethanimine |
| SMILES | [H]/N=C/C1=NCC2CC=CC=C2N1 |
| InChI | InChI=1S/C9H11N3/c10-5-9-11-6-7-3-1-2-4-8(7)12-9/h1-2,4-5,7,10H,3,6H2,(H,11,12)/b10-5+ |
| InChIKey | DXPZPOQLKCTBOO-BJMVGYQFSA-N |
| XLogP | 1.10 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|