C18H23N3OS2 — CID 91150943
N-methyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-2-(prop-2-enylsulfanylmethyl)butanamide (PubChem CID 91150943) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is N-methyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-2-(prop-2-enylsulfanylmethyl)butanamide.
| Compound Name | N-methyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-2-(prop-2-enylsulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 91150943 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-methyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-2-(prop-2-enylsulfanylmethyl)butanamide |
| SMILES | C=CCSCC(CC)C(=O)N(C)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C18H23N3OS2/c1-5-10-23-12-14(6-2)17(22)21(4)18-13(3)20-16(24-18)15-8-7-9-19-11-15/h5,7-9,11,14H,1,6,10,12H2,2-4H3 |
| InChIKey | XHACOHIKGIQYEG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|