C18H23N3O3S2 — CID 148952883
[(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-(2-methyl-3-sulfanylpropanoyl)amino]methyl butanoate (PubChem CID 148952883) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is [(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-(2-methyl-3-sulfanylpropanoyl)amino]methyl butanoate.
| Compound Name | [(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-(2-methyl-3-sulfanylpropanoyl)amino]methyl butanoate |
|---|---|
| PubChem CID | 148952883 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-(2-methyl-3-sulfanylpropanoyl)amino]methyl butanoate |
| SMILES | CCCC(=O)OCN(C(=O)C(C)CS)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C18H23N3O3S2/c1-4-6-15(22)24-11-21(17(23)12(2)10-25)18-13(3)20-16(26-18)14-7-5-8-19-9-14/h5,7-9,12,25H,4,6,10-11H2,1-3H3 |
| InChIKey | PQHFLEBGQYRMQT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|