C13H11N3O2S — CID 118023882
3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)prop-2-ynyl carbamate (PubChem CID 118023882) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)prop-2-ynyl carbamate.
| Compound Name | 3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)prop-2-ynyl carbamate |
|---|---|
| PubChem CID | 118023882 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)prop-2-ynyl carbamate |
| SMILES | Cc1nc(-c2cccnc2)sc1C#CCOC(N)=O |
| InChI | InChI=1S/C13H11N3O2S/c1-9-11(5-3-7-18-13(14)17)19-12(16-9)10-4-2-6-15-8-10/h2,4,6,8H,7H2,1H3,(H2,14,17) |
| InChIKey | BPDSZIUPHRKFPJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|