C16H12F6O8S2-2 — CID 91151629
2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;3-(trifluoromethoxy)benzenesulfonate (PubChem CID 91151629) has the molecular formula C16H12F6O8S2-2 and a molecular weight of 510.39 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;3-(trifluoromethoxy)benzenesulfonate.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;3-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 91151629 |
| Molecular Formula | C16H12F6O8S2-2 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;3-(trifluoromethoxy)benzenesulfonate |
| SMILES | Cc1ccc(OCC(F)(F)F)cc1S(=O)(=O)[O-].O=S(=O)([O-])c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3O4S.C7H5F3O4S/c1-6-2-3-7(16-5-9(10,11)12)4-8(6)17(13,14)15;8-7(9,10)14-5-2-1-3-6(4-5)15(11,12)13/h2-4H,5H2,1H3,(H,13,14,15);1-4H,(H,11,12,13)/p-2 |
| InChIKey | RCQJTCBTLDOIOF-UHFFFAOYSA-L |
| XLogP | 3.33 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|