C26H29F2N3O3+2 — CID 91151717
6-(6,6-diethyl-10,12-difluoro-2-methoxy-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one (PubChem CID 91151717) has the molecular formula C26H29F2N3O3+2 and a molecular weight of 469.53 g/mol. Its IUPAC name is 6-(6,6-diethyl-10,12-difluoro-2-methoxy-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one.
| Compound Name | 6-(6,6-diethyl-10,12-difluoro-2-methoxy-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
|---|---|
| PubChem CID | 91151717 |
| Molecular Formula | C26H29F2N3O3+2 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 6-(6,6-diethyl-10,12-difluoro-2-methoxy-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
| SMILES | CCC1(CC)CC(C2Cn3c[n+](C)cc3C(=O)O2)c2cc(F)cc(F)c2-c2cc(OC)cc[n+]21 |
| InChI | InChI=1S/C26H29F2N3O3/c1-5-26(6-2)12-19(23-14-30-15-29(3)13-22(30)25(32)34-23)18-9-16(27)10-20(28)24(18)21-11-17(33-4)7-8-31(21)26/h7-11,13,15,19,23H,5-6,12,14H2,1-4H3/q+2 |
| InChIKey | MSFNLPYJRKODDI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|